C35H37NO8 — CID 23546243
4-[[2-(4-carboxyphenoxy)ethyl-[2-[2-[[4-(2-methoxyethoxy)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 23546243) has the molecular formula C35H37NO8 and a molecular weight of 599.68 g/mol. Its IUPAC name is 4-[[2-(4-carboxyphenoxy)ethyl-[2-[2-[[4-(2-methoxyethoxy)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[2-(4-carboxyphenoxy)ethyl-[2-[2-[[4-(2-methoxyethoxy)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23546243 |
| Molecular Formula | C35H37NO8 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 4-[[2-(4-carboxyphenoxy)ethyl-[2-[2-[[4-(2-methoxyethoxy)phenyl]methoxy]phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | COCCOc1ccc(COc2ccccc2CCN(CCOc2ccc(C(=O)O)cc2)Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C35H37NO8/c1-41-22-23-43-31-14-8-27(9-15-31)25-44-33-5-3-2-4-28(33)18-19-36(24-26-6-10-29(11-7-26)34(37)38)20-21-42-32-16-12-30(13-17-32)35(39)40/h2-17H,18-25H2,1H3,(H,37,38)(H,39,40) |
| InChIKey | FQUITTXLFNRSKR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|