C38H47NO4 — CID 145046976
5-[2-[2-[[4-(2-cyclohexa-1,3-dien-1-ylethyl)phenyl]methoxy]phenyl]ethyl-[(4-formylphenyl)methyl]amino]pentanoic acid;ethane (PubChem CID 145046976) has the molecular formula C38H47NO4 and a molecular weight of 581.80 g/mol. Its IUPAC name is 5-[2-[2-[[4-(2-cyclohexa-1,3-dien-1-ylethyl)phenyl]methoxy]phenyl]ethyl-[(4-formylphenyl)methyl]amino]pentanoic acid;ethane.
| Compound Name | 5-[2-[2-[[4-(2-cyclohexa-1,3-dien-1-ylethyl)phenyl]methoxy]phenyl]ethyl-[(4-formylphenyl)methyl]amino]pentanoic acid;ethane |
|---|---|
| PubChem CID | 145046976 |
| Molecular Formula | C38H47NO4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | 5-[2-[2-[[4-(2-cyclohexa-1,3-dien-1-ylethyl)phenyl]methoxy]phenyl]ethyl-[(4-formylphenyl)methyl]amino]pentanoic acid;ethane |
| SMILES | CC.O=Cc1ccc(CN(CCCCC(=O)O)CCc2ccccc2OCc2ccc(CCC3=CC=CCC3)cc2)cc1 |
| InChI | InChI=1S/C36H41NO4.C2H6/c38-27-32-19-17-31(18-20-32)26-37(24-7-6-12-36(39)40)25-23-34-10-4-5-11-35(34)41-28-33-21-15-30(16-22-33)14-13-29-8-2-1-3-9-29;1-2/h1-2,4-5,8,10-11,15-22,27H,3,6-7,9,12-14,23-26,28H2,(H,39,40);1-2H3 |
| InChIKey | PAEJGRUFJVQLQD-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|