C35H39NO5 — CID 144830053
4-[[5-hydroxypentyl-[2-phenyl-2-[(4-phenylmethoxyphenyl)methoxy]ethyl]amino]methyl]benzoic acid (PubChem CID 144830053) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is 4-[[5-hydroxypentyl-[2-phenyl-2-[(4-phenylmethoxyphenyl)methoxy]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[5-hydroxypentyl-[2-phenyl-2-[(4-phenylmethoxyphenyl)methoxy]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 144830053 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 4-[[5-hydroxypentyl-[2-phenyl-2-[(4-phenylmethoxyphenyl)methoxy]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN(CCCCCO)CC(OCc2ccc(OCc3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H39NO5/c37-23-9-3-8-22-36(24-28-14-18-32(19-15-28)35(38)39)25-34(31-12-6-2-7-13-31)41-27-30-16-20-33(21-17-30)40-26-29-10-4-1-5-11-29/h1-2,4-7,10-21,34,37H,3,8-9,22-27H2,(H,38,39) |
| InChIKey | INIIUTMDXXMRFH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|