C38H40N2O6 — CID 140738394
methyl 4-[[(5-ethoxy-5-oxopentyl)-[(2R)-2-(3-isocyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]amino]methyl]benzoate (PubChem CID 140738394) has the molecular formula C38H40N2O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is methyl 4-[[(5-ethoxy-5-oxopentyl)-[(2R)-2-(3-isocyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-[(2R)-2-(3-isocyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 140738394 |
| Molecular Formula | C38H40N2O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | methyl 4-[[(5-ethoxy-5-oxopentyl)-[(2R)-2-(3-isocyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]amino]methyl]benzoate |
| SMILES | [C-]#[N+]c1cccc([C@H](CN(CCCCC(=O)OCC)Cc2ccc(C(=O)OC)cc2)OCc2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C38H40N2O6/c1-4-44-37(41)15-8-9-24-40(26-29-16-20-31(21-17-29)38(42)43-3)27-36(32-11-10-12-33(25-32)39-2)45-28-30-18-22-35(23-19-30)46-34-13-6-5-7-14-34/h5-7,10-14,16-23,25,36H,4,8-9,15,24,26-28H2,1,3H3/t36-/m0/s1 |
| InChIKey | UFCGOPKXSMMCPL-BHVANESWSA-N |
| XLogP | 8.31 |
| TPSA | 78.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|