C34H43NO5 — CID 122500995
methyl 4-[[[2-[(3-tert-butylphenyl)methoxy]-2-phenylethyl]-(5-methoxy-5-oxopentyl)amino]methyl]benzoate (PubChem CID 122500995) has the molecular formula C34H43NO5 and a molecular weight of 545.72 g/mol. Its IUPAC name is methyl 4-[[[2-[(3-tert-butylphenyl)methoxy]-2-phenylethyl]-(5-methoxy-5-oxopentyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[(3-tert-butylphenyl)methoxy]-2-phenylethyl]-(5-methoxy-5-oxopentyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 122500995 |
| Molecular Formula | C34H43NO5 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | methyl 4-[[[2-[(3-tert-butylphenyl)methoxy]-2-phenylethyl]-(5-methoxy-5-oxopentyl)amino]methyl]benzoate |
| SMILES | COC(=O)CCCCN(Cc1ccc(C(=O)OC)cc1)CC(OCc1cccc(C(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C34H43NO5/c1-34(2,3)30-15-11-12-27(22-30)25-40-31(28-13-7-6-8-14-28)24-35(21-10-9-16-32(36)38-4)23-26-17-19-29(20-18-26)33(37)39-5/h6-8,11-15,17-20,22,31H,9-10,16,21,23-25H2,1-5H3 |
| InChIKey | KPHOIVFDLYEQJZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|