C38H40N2O6 — CID 122535095
methyl 4-[[[(2R)-2-(3-cyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]-(5-ethoxy-5-oxopentyl)amino]methyl]benzoate (PubChem CID 122535095) has the molecular formula C38H40N2O6 and a molecular weight of 620.75 g/mol. Its IUPAC name is methyl 4-[[[(2R)-2-(3-cyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]-(5-ethoxy-5-oxopentyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(2R)-2-(3-cyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]-(5-ethoxy-5-oxopentyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 122535095 |
| Molecular Formula | C38H40N2O6 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.29 |
| IUPAC Name | methyl 4-[[[(2R)-2-(3-cyanophenyl)-2-[(4-phenoxyphenyl)methoxy]ethyl]-(5-ethoxy-5-oxopentyl)amino]methyl]benzoate |
| SMILES | CCOC(=O)CCCCN(Cc1ccc(C(=O)OC)cc1)C[C@H](OCc1ccc(Oc2ccccc2)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C38H40N2O6/c1-3-44-37(41)14-7-8-23-40(26-29-15-19-32(20-16-29)38(42)43-2)27-36(33-11-9-10-31(24-33)25-39)45-28-30-17-21-35(22-18-30)46-34-12-5-4-6-13-34/h4-6,9-13,15-22,24,36H,3,7-8,14,23,26-28H2,1-2H3/t36-/m0/s1 |
| InChIKey | MSOHODUYGYRWPD-BHVANESWSA-N |
| XLogP | 7.63 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|