C33H42O4 — CID 70147359
methyl 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]octan-3-yloxy]benzoate (PubChem CID 70147359) has the molecular formula C33H42O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is methyl 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]octan-3-yloxy]benzoate.
| Compound Name | methyl 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]octan-3-yloxy]benzoate |
|---|---|
| PubChem CID | 70147359 |
| Molecular Formula | C33H42O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | methyl 4-[1-[2-[(4-tert-butylphenyl)methoxy]phenyl]octan-3-yloxy]benzoate |
| SMILES | CCCCCC(CCc1ccccc1OCc1ccc(C(C)(C)C)cc1)Oc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C33H42O4/c1-6-7-8-12-29(37-30-22-17-27(18-23-30)32(34)35-5)21-16-26-11-9-10-13-31(26)36-24-25-14-19-28(20-15-25)33(2,3)4/h9-11,13-15,17-20,22-23,29H,6-8,12,16,21,24H2,1-5H3 |
| InChIKey | VAIHLNFPJKAUTH-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|