C30H34O5 — CID 22288037
3-(4-decan-4-yloxybenzoyl)oxy-4-phenylbenzoic acid (PubChem CID 22288037) has the molecular formula C30H34O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-(4-decan-4-yloxybenzoyl)oxy-4-phenylbenzoic acid.
| Compound Name | 3-(4-decan-4-yloxybenzoyl)oxy-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 22288037 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 3-(4-decan-4-yloxybenzoyl)oxy-4-phenylbenzoic acid |
| SMILES | CCCCCCC(CCC)Oc1ccc(C(=O)Oc2cc(C(=O)O)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H34O5/c1-3-5-6-10-14-25(11-4-2)34-26-18-15-23(16-19-26)30(33)35-28-21-24(29(31)32)17-20-27(28)22-12-8-7-9-13-22/h7-9,12-13,15-21,25H,3-6,10-11,14H2,1-2H3,(H,31,32) |
| InChIKey | LUSNBLAQIFHURL-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|