C28H38O5 — CID 70274616
3-[1-[(3-methyloxetan-3-yl)methoxy]decoxy]-4-phenylbenzoic acid (PubChem CID 70274616) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 3-[1-[(3-methyloxetan-3-yl)methoxy]decoxy]-4-phenylbenzoic acid.
| Compound Name | 3-[1-[(3-methyloxetan-3-yl)methoxy]decoxy]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 70274616 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-[1-[(3-methyloxetan-3-yl)methoxy]decoxy]-4-phenylbenzoic acid |
| SMILES | CCCCCCCCCC(OCC1(C)COC1)Oc1cc(C(=O)O)ccc1-c1ccccc1 |
| InChI | InChI=1S/C28H38O5/c1-3-4-5-6-7-8-12-15-26(32-21-28(2)19-31-20-28)33-25-18-23(27(29)30)16-17-24(25)22-13-10-9-11-14-22/h9-11,13-14,16-18,26H,3-8,12,15,19-21H2,1-2H3,(H,29,30) |
| InChIKey | AWJKOZPWJDLPJS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|