C42H57FO6 — CID 70273180
[2-fluoro-4-[4-[(2R)-octan-2-yl]oxyphenyl]phenyl] 4-[10-[(3-methyloxetan-3-yl)methoxy]decoxy]benzoate (PubChem CID 70273180) has the molecular formula C42H57FO6 and a molecular weight of 676.91 g/mol. Its IUPAC name is [2-fluoro-4-[4-[(2R)-octan-2-yl]oxyphenyl]phenyl] 4-[10-[(3-methyloxetan-3-yl)methoxy]decoxy]benzoate.
| Compound Name | [2-fluoro-4-[4-[(2R)-octan-2-yl]oxyphenyl]phenyl] 4-[10-[(3-methyloxetan-3-yl)methoxy]decoxy]benzoate |
|---|---|
| PubChem CID | 70273180 |
| Molecular Formula | C42H57FO6 |
| Molecular Weight | 676.91 g/mol |
| Exact Mass | 676.41 |
| IUPAC Name | [2-fluoro-4-[4-[(2R)-octan-2-yl]oxyphenyl]phenyl] 4-[10-[(3-methyloxetan-3-yl)methoxy]decoxy]benzoate |
| SMILES | CCCCCC[C@@H](C)Oc1ccc(-c2ccc(OC(=O)c3ccc(OCCCCCCCCCCOCC4(C)COC4)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C42H57FO6/c1-4-5-6-13-16-33(2)48-38-24-17-34(18-25-38)36-21-26-40(39(43)29-36)49-41(44)35-19-22-37(23-20-35)47-28-15-12-10-8-7-9-11-14-27-45-30-42(3)31-46-32-42/h17-26,29,33H,4-16,27-28,30-32H2,1-3H3/t33-/m1/s1 |
| InChIKey | VDNXCJPXVPBWHL-MGBGTMOVSA-N |
| XLogP | 11.00 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.91 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|