methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate

C23H22O4 — CID 18973865

IUPACmethyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate
SMILESCOC(=O)c1ccc(CCc2ccccc2OCc2ccccc2)c(O)c1
InChIInChI=1S/C23H22O4/c1-26-23(25)20-14-12-18(21(24)15-20)11-13-19-9-5-6-10-22(19)27-16-17-7-3-2-4-8-17/h2-10,12,14-15,24H,11,13,16H2,1H3
InChIKeyLIJXHECMXMMTRS-UHFFFAOYSA-N
MW362.43 g/mol
LogP4.54
Rot. Bonds7

About methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate

methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate (PubChem CID 18973865) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate.

Molecular Properties

Compound Namemethyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate
PubChem CID18973865
Molecular FormulaC23H22O4
Molecular Weight362.43 g/mol
Exact Mass362.15
IUPAC Namemethyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate
SMILESCOC(=O)c1ccc(CCc2ccccc2OCc2ccccc2)c(O)c1
InChIInChI=1S/C23H22O4/c1-26-23(25)20-14-12-18(21(24)15-20)11-13-19-9-5-6-10-22(19)27-16-17-7-3-2-4-8-17/h2-10,12,14-15,24H,11,13,16H2,1H3
InChIKeyLIJXHECMXMMTRS-UHFFFAOYSA-N
XLogP4.54
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.43
LogP ≤ 54.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate?
The IUPAC name of methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate (CID 18973865) is methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate.
What is the SMILES notation for methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate?
The canonical SMILES for methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate is COC(=O)c1ccc(CCc2ccccc2OCc2ccccc2)c(O)c1.
What is the InChIKey of methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate?
The InChIKey is LIJXHECMXMMTRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O4/c1-26-23(25)20-14-12-18(21(24)15-20)11-13-19-9-5-6-10-22(19)27-16-17-7-3-2-4-8-17/h2-10,12,14-15,24H,11,13,16H2,1H3.
What are the key properties of methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate?
methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate has a molecular weight of 362.43 g/mol, XLogP of 4.54, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate is sourced from PubChem (CID 18973865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).