C23H22O4 — CID 18973865
methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate (PubChem CID 18973865) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate.
| Compound Name | methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 18973865 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl 3-hydroxy-4-[2-(2-phenylmethoxyphenyl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2ccccc2OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C23H22O4/c1-26-23(25)20-14-12-18(21(24)15-20)11-13-19-9-5-6-10-22(19)27-16-17-7-3-2-4-8-17/h2-10,12,14-15,24H,11,13,16H2,1H3 |
| InChIKey | LIJXHECMXMMTRS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |