C22H20BrNO2 — CID 18974069
3-bromo-4-[2-(2-phenylmethoxyphenyl)ethyl]benzamide (PubChem CID 18974069) has the molecular formula C22H20BrNO2 and a molecular weight of 410.31 g/mol. Its IUPAC name is 3-bromo-4-[2-(2-phenylmethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-bromo-4-[2-(2-phenylmethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 18974069 |
| Molecular Formula | C22H20BrNO2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-bromo-4-[2-(2-phenylmethoxyphenyl)ethyl]benzamide |
| SMILES | NC(=O)c1ccc(CCc2ccccc2OCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C22H20BrNO2/c23-20-14-19(22(24)25)13-11-17(20)10-12-18-8-4-5-9-21(18)26-15-16-6-2-1-3-7-16/h1-9,11,13-14H,10,12,15H2,(H2,24,25) |
| InChIKey | VMYRHZRLLKSISE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |