C30H28O5S — CID 57218659
methyl 4-[[4-(benzenesulfonylmethyl)-2-(2-phenylethyl)phenoxy]methyl]benzoate (PubChem CID 57218659) has the molecular formula C30H28O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is methyl 4-[[4-(benzenesulfonylmethyl)-2-(2-phenylethyl)phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-(benzenesulfonylmethyl)-2-(2-phenylethyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 57218659 |
| Molecular Formula | C30H28O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | methyl 4-[[4-(benzenesulfonylmethyl)-2-(2-phenylethyl)phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(CS(=O)(=O)c3ccccc3)cc2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28O5S/c1-34-30(31)26-16-13-24(14-17-26)21-35-29-19-15-25(22-36(32,33)28-10-6-3-7-11-28)20-27(29)18-12-23-8-4-2-5-9-23/h2-11,13-17,19-20H,12,18,21-22H2,1H3 |
| InChIKey | IQBIBNWGXOZANB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |