C26H28O3S — CID 18974083
methyl 4-[3-[5-(methylsulfanylmethyl)-2-phenylmethoxyphenyl]propyl]benzoate (PubChem CID 18974083) has the molecular formula C26H28O3S and a molecular weight of 420.57 g/mol. Its IUPAC name is methyl 4-[3-[5-(methylsulfanylmethyl)-2-phenylmethoxyphenyl]propyl]benzoate.
| Compound Name | methyl 4-[3-[5-(methylsulfanylmethyl)-2-phenylmethoxyphenyl]propyl]benzoate |
|---|---|
| PubChem CID | 18974083 |
| Molecular Formula | C26H28O3S |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | methyl 4-[3-[5-(methylsulfanylmethyl)-2-phenylmethoxyphenyl]propyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCc2cc(CSC)ccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O3S/c1-28-26(27)23-14-11-20(12-15-23)9-6-10-24-17-22(19-30-2)13-16-25(24)29-18-21-7-4-3-5-8-21/h3-5,7-8,11-17H,6,9-10,18-19H2,1-2H3 |
| InChIKey | WSJQMHRFSJMTIO-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |