C26H28O4S — CID 70346310
methyl 4-[3-(3-methyl-5-methylsulfinyl-2-phenylmethoxyphenyl)propyl]benzoate (PubChem CID 70346310) has the molecular formula C26H28O4S and a molecular weight of 436.57 g/mol. Its IUPAC name is methyl 4-[3-(3-methyl-5-methylsulfinyl-2-phenylmethoxyphenyl)propyl]benzoate.
| Compound Name | methyl 4-[3-(3-methyl-5-methylsulfinyl-2-phenylmethoxyphenyl)propyl]benzoate |
|---|---|
| PubChem CID | 70346310 |
| Molecular Formula | C26H28O4S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | methyl 4-[3-(3-methyl-5-methylsulfinyl-2-phenylmethoxyphenyl)propyl]benzoate |
| SMILES | COC(=O)c1ccc(CCCc2cc(S(C)=O)cc(C)c2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28O4S/c1-19-16-24(31(3)28)17-23(25(19)30-18-21-8-5-4-6-9-21)11-7-10-20-12-14-22(15-13-20)26(27)29-2/h4-6,8-9,12-17H,7,10-11,18H2,1-3H3 |
| InChIKey | ZIKPHEYJLJNZIJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |