C34H32O8S2 — CID 11239076
1-[4-[2-[[4-acetyl-2-(benzenesulfonylmethyl)phenoxy]methyl]prop-2-enoxy]-3-(benzenesulfonylmethyl)phenyl]ethanone (PubChem CID 11239076) has the molecular formula C34H32O8S2 and a molecular weight of 632.76 g/mol. Its IUPAC name is 1-[4-[2-[[4-acetyl-2-(benzenesulfonylmethyl)phenoxy]methyl]prop-2-enoxy]-3-(benzenesulfonylmethyl)phenyl]ethanone.
| Compound Name | 1-[4-[2-[[4-acetyl-2-(benzenesulfonylmethyl)phenoxy]methyl]prop-2-enoxy]-3-(benzenesulfonylmethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 11239076 |
| Molecular Formula | C34H32O8S2 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | 1-[4-[2-[[4-acetyl-2-(benzenesulfonylmethyl)phenoxy]methyl]prop-2-enoxy]-3-(benzenesulfonylmethyl)phenyl]ethanone |
| SMILES | C=C(COc1ccc(C(C)=O)cc1CS(=O)(=O)c1ccccc1)COc1ccc(C(C)=O)cc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H32O8S2/c1-24(20-41-33-16-14-27(25(2)35)18-29(33)22-43(37,38)31-10-6-4-7-11-31)21-42-34-17-15-28(26(3)36)19-30(34)23-44(39,40)32-12-8-5-9-13-32/h4-19H,1,20-23H2,2-3H3 |
| InChIKey | YJBBHTQWKREZCP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|