C15H22O4S — CID 64642742
1-[3-(tert-butylsulfonylmethyl)-4-ethoxyphenyl]ethanone (PubChem CID 64642742) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-[3-(tert-butylsulfonylmethyl)-4-ethoxyphenyl]ethanone.
| Compound Name | 1-[3-(tert-butylsulfonylmethyl)-4-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 64642742 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-[3-(tert-butylsulfonylmethyl)-4-ethoxyphenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H22O4S/c1-6-19-14-8-7-12(11(2)16)9-13(14)10-20(17,18)15(3,4)5/h7-9H,6,10H2,1-5H3 |
| InChIKey | OSYVFMSWNWPZAG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |