C16H24O4 — CID 60862201
1-[4-ethoxy-3-(2-propan-2-yloxyethoxymethyl)phenyl]ethanone (PubChem CID 60862201) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(2-propan-2-yloxyethoxymethyl)phenyl]ethanone.
| Compound Name | 1-[4-ethoxy-3-(2-propan-2-yloxyethoxymethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 60862201 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[4-ethoxy-3-(2-propan-2-yloxyethoxymethyl)phenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1COCCOC(C)C |
| InChI | InChI=1S/C16H24O4/c1-5-19-16-7-6-14(13(4)17)10-15(16)11-18-8-9-20-12(2)3/h6-7,10,12H,5,8-9,11H2,1-4H3 |
| InChIKey | GNDXHDAZOHTMLQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|