C17H25NO2 — CID 60644688
1-[3-(azepan-1-ylmethyl)-4-ethoxyphenyl]ethanone (PubChem CID 60644688) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[3-(azepan-1-ylmethyl)-4-ethoxyphenyl]ethanone.
| Compound Name | 1-[3-(azepan-1-ylmethyl)-4-ethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 60644688 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[3-(azepan-1-ylmethyl)-4-ethoxyphenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1CN1CCCCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-3-20-17-9-8-15(14(2)19)12-16(17)13-18-10-6-4-5-7-11-18/h8-9,12H,3-7,10-11,13H2,1-2H3 |
| InChIKey | NNEXUQYDIPZUHC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |