C16H21NO3 — CID 62656647
1-[(5-acetyl-2-methoxyphenyl)methyl]piperidine-4-carbaldehyde (PubChem CID 62656647) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[(5-acetyl-2-methoxyphenyl)methyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[(5-acetyl-2-methoxyphenyl)methyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 62656647 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[(5-acetyl-2-methoxyphenyl)methyl]piperidine-4-carbaldehyde |
| SMILES | COc1ccc(C(C)=O)cc1CN1CCC(C=O)CC1 |
| InChI | InChI=1S/C16H21NO3/c1-12(19)14-3-4-16(20-2)15(9-14)10-17-7-5-13(11-18)6-8-17/h3-4,9,11,13H,5-8,10H2,1-2H3 |
| InChIKey | QQVFHPSMPVTUCT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|