C19H31ClN2O2 — CID 119927768
1-[4-ethoxy-3-[[4-(ethylaminomethyl)piperidin-1-yl]methyl]phenyl]ethanone;hydrochloride (PubChem CID 119927768) has the molecular formula C19H31ClN2O2 and a molecular weight of 354.92 g/mol. Its IUPAC name is 1-[4-ethoxy-3-[[4-(ethylaminomethyl)piperidin-1-yl]methyl]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-ethoxy-3-[[4-(ethylaminomethyl)piperidin-1-yl]methyl]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119927768 |
| Molecular Formula | C19H31ClN2O2 |
| Molecular Weight | 354.92 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[4-ethoxy-3-[[4-(ethylaminomethyl)piperidin-1-yl]methyl]phenyl]ethanone;hydrochloride |
| SMILES | CCNCC1CCN(Cc2cc(C(C)=O)ccc2OCC)CC1.Cl |
| InChI | InChI=1S/C19H30N2O2.ClH/c1-4-20-13-16-8-10-21(11-9-16)14-18-12-17(15(3)22)6-7-19(18)23-5-2;/h6-7,12,16,20H,4-5,8-11,13-14H2,1-3H3;1H |
| InChIKey | UKTASWHSTMKZNM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |