C24H25NO6S — CID 18974010
methyl 5-methyl-6-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 18974010) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is methyl 5-methyl-6-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | methyl 5-methyl-6-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 18974010 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | methyl 5-methyl-6-[2-(5-methylsulfonyl-2-phenylmethoxyphenyl)ethyl]-1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1cc(C)c(CCc2cc(S(C)(=O)=O)ccc2OCc2ccccc2)[n+]([O-])c1 |
| InChI | InChI=1S/C24H25NO6S/c1-17-13-20(24(26)30-2)15-25(27)22(17)11-9-19-14-21(32(3,28)29)10-12-23(19)31-16-18-7-5-4-6-8-18/h4-8,10,12-15H,9,11,16H2,1-3H3 |
| InChIKey | BEDNIHVJBZWQTA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|