C35H42O5 — CID 20764283
methyl 2-[7-methoxy-7-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]heptyl]benzoate (PubChem CID 20764283) has the molecular formula C35H42O5 and a molecular weight of 542.72 g/mol. Its IUPAC name is methyl 2-[7-methoxy-7-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]heptyl]benzoate.
| Compound Name | methyl 2-[7-methoxy-7-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]heptyl]benzoate |
|---|---|
| PubChem CID | 20764283 |
| Molecular Formula | C35H42O5 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | methyl 2-[7-methoxy-7-oxo-2-[(E)-2-[2-(5-phenylpentoxy)phenyl]ethenyl]heptyl]benzoate |
| SMILES | COC(=O)CCCCC(/C=C/c1ccccc1OCCCCCc1ccccc1)Cc1ccccc1C(=O)OC |
| InChI | InChI=1S/C35H42O5/c1-38-34(36)23-13-8-18-29(27-31-20-9-11-21-32(31)35(37)39-2)24-25-30-19-10-12-22-33(30)40-26-14-4-7-17-28-15-5-3-6-16-28/h3,5-6,9-12,15-16,19-22,24-25,29H,4,7-8,13-14,17-18,23,26-27H2,1-2H3/b25-24+ |
| InChIKey | BUWCNIPIVRHWFZ-OCOZRVBESA-N |
| XLogP | 7.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|