C26H34O4 — CID 23118876
methyl (E)-6-hydroxy-8-[2-(5-phenylpentoxy)phenyl]oct-7-enoate (PubChem CID 23118876) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is methyl (E)-6-hydroxy-8-[2-(5-phenylpentoxy)phenyl]oct-7-enoate.
| Compound Name | methyl (E)-6-hydroxy-8-[2-(5-phenylpentoxy)phenyl]oct-7-enoate |
|---|---|
| PubChem CID | 23118876 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | methyl (E)-6-hydroxy-8-[2-(5-phenylpentoxy)phenyl]oct-7-enoate |
| SMILES | COC(=O)CCCCC(O)/C=C/c1ccccc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C26H34O4/c1-29-26(28)18-10-8-16-24(27)20-19-23-15-7-9-17-25(23)30-21-11-3-6-14-22-12-4-2-5-13-22/h2,4-5,7,9,12-13,15,17,19-20,24,27H,3,6,8,10-11,14,16,18,21H2,1H3/b20-19+ |
| InChIKey | QELJTTIRZDDBLX-FMQUCBEESA-N |
| XLogP | 5.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|