C23H34O4 — CID 19799760
2-[2-[(1E,3E)-5-hydroxytrideca-1,3-dienyl]phenoxy]ethyl acetate (PubChem CID 19799760) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[2-[(1E,3E)-5-hydroxytrideca-1,3-dienyl]phenoxy]ethyl acetate.
| Compound Name | 2-[2-[(1E,3E)-5-hydroxytrideca-1,3-dienyl]phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 19799760 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[2-[(1E,3E)-5-hydroxytrideca-1,3-dienyl]phenoxy]ethyl acetate |
| SMILES | CCCCCCCCC(O)/C=C/C=C/c1ccccc1OCCOC(C)=O |
| InChI | InChI=1S/C23H34O4/c1-3-4-5-6-7-8-15-22(25)16-11-9-13-21-14-10-12-17-23(21)27-19-18-26-20(2)24/h9-14,16-17,22,25H,3-8,15,18-19H2,1-2H3/b13-9+,16-11+ |
| InChIKey | LLPWNXQUBYYYEN-XBLSULRXSA-N |
| XLogP | 5.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|