C25H35IO5 — CID 89085812
iodomethyl (E,5S)-7-[2-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]phenyl]-5-hydroxyhept-6-enoate (PubChem CID 89085812) has the molecular formula C25H35IO5 and a molecular weight of 542.45 g/mol. Its IUPAC name is iodomethyl (E,5S)-7-[2-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]phenyl]-5-hydroxyhept-6-enoate.
| Compound Name | iodomethyl (E,5S)-7-[2-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]phenyl]-5-hydroxyhept-6-enoate |
|---|---|
| PubChem CID | 89085812 |
| Molecular Formula | C25H35IO5 |
| Molecular Weight | 542.45 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | iodomethyl (E,5S)-7-[2-[(1E,3E,5R,6S)-5,6-dihydroxyundeca-1,3-dienyl]phenyl]-5-hydroxyhept-6-enoate |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/C=C/c1ccccc1/C=C/[C@@H](O)CCCC(=O)OCI |
| InChI | InChI=1S/C25H35IO5/c1-2-3-4-14-23(28)24(29)15-8-7-11-20-10-5-6-12-21(20)17-18-22(27)13-9-16-25(30)31-19-26/h5-8,10-12,15,17-18,22-24,27-29H,2-4,9,13-14,16,19H2,1H3/b11-7+,15-8+,18-17+/t22-,23-,24+/m0/s1 |
| InChIKey | WWMJRFFDAOCIOQ-CJUWQFBHSA-N |
| XLogP | 5.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|