C22H32O4 — CID 126603596
(E,5S,6R)-5,6-dihydroxy-8-[2-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enal (PubChem CID 126603596) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (E,5S,6R)-5,6-dihydroxy-8-[2-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enal.
| Compound Name | (E,5S,6R)-5,6-dihydroxy-8-[2-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enal |
|---|---|
| PubChem CID | 126603596 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (E,5S,6R)-5,6-dihydroxy-8-[2-[(E,3R)-3-hydroxyoct-1-enyl]phenyl]oct-7-enal |
| SMILES | CCCCC[C@@H](O)/C=C/c1ccccc1/C=C/[C@@H](O)[C@@H](O)CCCC=O |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-11-20(24)15-13-18-9-5-6-10-19(18)14-16-22(26)21(25)12-7-8-17-23/h5-6,9-10,13-17,20-22,24-26H,2-4,7-8,11-12H2,1H3/b15-13+,16-14+/t20-,21+,22-/m1/s1 |
| InChIKey | FJAOQJDIXZMUSV-QMHAZQIESA-N |
| XLogP | 3.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|