C24H33NO5 — CID 146890119
methyl (E,5S,6R)-5,6-dihydroxy-8-[4-(1-hydroxyhexyl)quinolin-3-yl]oct-7-enoate (PubChem CID 146890119) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is methyl (E,5S,6R)-5,6-dihydroxy-8-[4-(1-hydroxyhexyl)quinolin-3-yl]oct-7-enoate.
| Compound Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-(1-hydroxyhexyl)quinolin-3-yl]oct-7-enoate |
|---|---|
| PubChem CID | 146890119 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-(1-hydroxyhexyl)quinolin-3-yl]oct-7-enoate |
| SMILES | CCCCCC(O)c1c(/C=C/[C@@H](O)[C@@H](O)CCCC(=O)OC)cnc2ccccc12 |
| InChI | InChI=1S/C24H33NO5/c1-3-4-5-11-22(28)24-17(16-25-19-10-7-6-9-18(19)24)14-15-21(27)20(26)12-8-13-23(29)30-2/h6-7,9-10,14-16,20-22,26-28H,3-5,8,11-13H2,1-2H3/b15-14+/t20-,21+,22?/m0/s1 |
| InChIKey | SZAQNOIUOVYBAT-QBOAFYBBSA-N |
| XLogP | 3.93 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|