C20H31NO5 — CID 46830367
methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-3-pyridinyl]oct-7-enoate (PubChem CID 46830367) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-3-pyridinyl]oct-7-enoate.
| Compound Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-3-pyridinyl]oct-7-enoate |
|---|---|
| PubChem CID | 46830367 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]-3-pyridinyl]oct-7-enoate |
| SMILES | CCCCC[C@@H](O)c1ccncc1/C=C/[C@@H](O)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C20H31NO5/c1-3-4-5-7-17(22)16-12-13-21-14-15(16)10-11-19(24)18(23)8-6-9-20(25)26-2/h10-14,17-19,22-24H,3-9H2,1-2H3/b11-10+/t17-,18+,19-/m1/s1 |
| InChIKey | JUOOPYGRSFLTLL-RXGQBHOASA-N |
| XLogP | 2.77 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|