C23H34O5 — CID 66735812
methyl (5S,6R)-5,6-dihydroxy-8-[3-(3-hydroxyoct-1-enyl)phenyl]oct-7-enoate (PubChem CID 66735812) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (5S,6R)-5,6-dihydroxy-8-[3-(3-hydroxyoct-1-enyl)phenyl]oct-7-enoate.
| Compound Name | methyl (5S,6R)-5,6-dihydroxy-8-[3-(3-hydroxyoct-1-enyl)phenyl]oct-7-enoate |
|---|---|
| PubChem CID | 66735812 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (5S,6R)-5,6-dihydroxy-8-[3-(3-hydroxyoct-1-enyl)phenyl]oct-7-enoate |
| SMILES | CCCCCC(O)C=Cc1cccc(C=C[C@@H](O)[C@@H](O)CCCC(=O)OC)c1 |
| InChI | InChI=1S/C23H34O5/c1-3-4-5-10-20(24)15-13-18-8-6-9-19(17-18)14-16-22(26)21(25)11-7-12-23(27)28-2/h6,8-9,13-17,20-22,24-26H,3-5,7,10-12H2,1-2H3/t20?,21-,22+/m0/s1 |
| InChIKey | BGMWMUFLETWNBH-JTGIGXABSA-N |
| XLogP | 3.72 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|