C19H30N2O5 — CID 134275761
methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]pyrimidin-5-yl]oct-7-enoate (PubChem CID 134275761) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]pyrimidin-5-yl]oct-7-enoate.
| Compound Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]pyrimidin-5-yl]oct-7-enoate |
|---|---|
| PubChem CID | 134275761 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (E,5S,6R)-5,6-dihydroxy-8-[4-[(1R)-1-hydroxyhexyl]pyrimidin-5-yl]oct-7-enoate |
| SMILES | CCCCC[C@@H](O)c1ncncc1/C=C/[C@@H](O)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C19H30N2O5/c1-3-4-5-7-17(24)19-14(12-20-13-21-19)10-11-16(23)15(22)8-6-9-18(25)26-2/h10-13,15-17,22-24H,3-9H2,1-2H3/b11-10+/t15-,16+,17+/m0/s1 |
| InChIKey | MSLCKVKDUWEAJX-RYECOSQUSA-N |
| XLogP | 2.17 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|