C22H36O5 — CID 10134397
methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxy-10-methylicosa-6,8,10,12-tetraenoate (PubChem CID 10134397) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxy-10-methylicosa-6,8,10,12-tetraenoate.
| Compound Name | methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxy-10-methylicosa-6,8,10,12-tetraenoate |
|---|---|
| PubChem CID | 10134397 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | methyl (5S,6E,8Z,10E,12E,14R,15S)-5,14,15-trihydroxy-10-methylicosa-6,8,10,12-tetraenoate |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/C=C(C)/C=C\C=C\[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C22H36O5/c1-4-5-6-15-20(24)21(25)16-9-12-18(2)11-7-8-13-19(23)14-10-17-22(26)27-3/h7-9,11-13,16,19-21,23-25H,4-6,10,14-15,17H2,1-3H3/b11-7-,13-8+,16-9+,18-12+/t19-,20+,21-/m1/s1 |
| InChIKey | QOSLYRFDQWRGLV-UFBQTXGWSA-N |
| XLogP | 3.61 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|