C24H38O5 — CID 10179525
methyl (5S,6R,7E,9E,11Z,13E,15E,17S)-5,6,17-trihydroxy-16-methyldocosa-7,9,11,13,15-pentaenoate (PubChem CID 10179525) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is methyl (5S,6R,7E,9E,11Z,13E,15E,17S)-5,6,17-trihydroxy-16-methyldocosa-7,9,11,13,15-pentaenoate.
| Compound Name | methyl (5S,6R,7E,9E,11Z,13E,15E,17S)-5,6,17-trihydroxy-16-methyldocosa-7,9,11,13,15-pentaenoate |
|---|---|
| PubChem CID | 10179525 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | methyl (5S,6R,7E,9E,11Z,13E,15E,17S)-5,6,17-trihydroxy-16-methyldocosa-7,9,11,13,15-pentaenoate |
| SMILES | CCCCC[C@H](O)/C(C)=C/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)OC |
| InChI | InChI=1S/C24H38O5/c1-4-5-11-16-21(25)20(2)15-12-9-7-6-8-10-13-17-22(26)23(27)18-14-19-24(28)29-3/h6-10,12-13,15,17,21-23,25-27H,4-5,11,14,16,18-19H2,1-3H3/b7-6-,10-8+,12-9+,17-13+,20-15+/t21-,22+,23-/m0/s1 |
| InChIKey | DRFPBTIBNPHVOO-QEPGIQRKSA-N |
| XLogP | 4.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|