C24H38O5 — CID 91221953
methyl (5S)-8-[3-[(3R,4R)-3,4-dihydroxynon-1-enyl]cyclohex-2-en-1-ylidene]-5-hydroxyoct-6-enoate (PubChem CID 91221953) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is methyl (5S)-8-[3-[(3R,4R)-3,4-dihydroxynon-1-enyl]cyclohex-2-en-1-ylidene]-5-hydroxyoct-6-enoate.
| Compound Name | methyl (5S)-8-[3-[(3R,4R)-3,4-dihydroxynon-1-enyl]cyclohex-2-en-1-ylidene]-5-hydroxyoct-6-enoate |
|---|---|
| PubChem CID | 91221953 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | methyl (5S)-8-[3-[(3R,4R)-3,4-dihydroxynon-1-enyl]cyclohex-2-en-1-ylidene]-5-hydroxyoct-6-enoate |
| SMILES | CCCCC[C@@H](O)[C@H](O)C=CC1=CC(=CC=C[C@@H](O)CCCC(=O)OC)CCC1 |
| InChI | InChI=1S/C24H38O5/c1-3-4-5-14-22(26)23(27)17-16-20-10-6-9-19(18-20)11-7-12-21(25)13-8-15-24(28)29-2/h7,11-12,16-18,21-23,25-27H,3-6,8-10,13-15H2,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | SDQJEHAWVWNFON-DNVJHFABSA-N |
| XLogP | 4.14 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|