C24H38O4 — CID 134358325
methyl (E,5S,8Z)-5-hydroxy-8-[3-[(E,4R)-4-hydroxynon-1-enyl]cyclohex-2-en-1-ylidene]oct-6-enoate (PubChem CID 134358325) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is methyl (E,5S,8Z)-5-hydroxy-8-[3-[(E,4R)-4-hydroxynon-1-enyl]cyclohex-2-en-1-ylidene]oct-6-enoate.
| Compound Name | methyl (E,5S,8Z)-5-hydroxy-8-[3-[(E,4R)-4-hydroxynon-1-enyl]cyclohex-2-en-1-ylidene]oct-6-enoate |
|---|---|
| PubChem CID | 134358325 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | methyl (E,5S,8Z)-5-hydroxy-8-[3-[(E,4R)-4-hydroxynon-1-enyl]cyclohex-2-en-1-ylidene]oct-6-enoate |
| SMILES | CCCCC[C@@H](O)C/C=C/C1=C/C(=C\C=C\[C@@H](O)CCCC(=O)OC)CCC1 |
| InChI | InChI=1S/C24H38O4/c1-3-4-5-14-22(25)15-7-12-20-10-6-11-21(19-20)13-8-16-23(26)17-9-18-24(27)28-2/h7-8,12-13,16,19,22-23,25-26H,3-6,9-11,14-15,17-18H2,1-2H3/b12-7+,16-8+,21-13-/t22-,23-/m1/s1 |
| InChIKey | CCGLKZMUWHMKCS-RAOMJZPOSA-N |
| XLogP | 5.17 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|