C24H34O4 — CID 15067617
5-[2-[(1E,3E)-5-acetyloxyundeca-1,3-dienyl]phenyl]pentanoic acid (PubChem CID 15067617) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 5-[2-[(1E,3E)-5-acetyloxyundeca-1,3-dienyl]phenyl]pentanoic acid.
| Compound Name | 5-[2-[(1E,3E)-5-acetyloxyundeca-1,3-dienyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 15067617 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 5-[2-[(1E,3E)-5-acetyloxyundeca-1,3-dienyl]phenyl]pentanoic acid |
| SMILES | CCCCCCC(/C=C/C=C/c1ccccc1CCCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C24H34O4/c1-3-4-5-6-17-23(28-20(2)25)18-11-9-15-21-13-7-8-14-22(21)16-10-12-19-24(26)27/h7-9,11,13-15,18,23H,3-6,10,12,16-17,19H2,1-2H3,(H,26,27)/b15-9+,18-11+ |
| InChIKey | SYARZTKFROOZSC-KIYPEOPRSA-N |
| XLogP | 5.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|