C25H38O4 — CID 54379089
5-hydroxy-5-[2-(5-methoxytrideca-1,3-dienyl)phenyl]pentanoic acid (PubChem CID 54379089) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 5-hydroxy-5-[2-(5-methoxytrideca-1,3-dienyl)phenyl]pentanoic acid.
| Compound Name | 5-hydroxy-5-[2-(5-methoxytrideca-1,3-dienyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 54379089 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 5-hydroxy-5-[2-(5-methoxytrideca-1,3-dienyl)phenyl]pentanoic acid |
| SMILES | CCCCCCCCC(C=CC=Cc1ccccc1C(O)CCCC(=O)O)OC |
| InChI | InChI=1S/C25H38O4/c1-3-4-5-6-7-8-16-22(29-2)17-11-9-14-21-15-10-12-18-23(21)24(26)19-13-20-25(27)28/h9-12,14-15,17-18,22,24,26H,3-8,13,16,19-20H2,1-2H3,(H,27,28) |
| InChIKey | UYRFDPYQOYSOCS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|