C26H40O3 — CID 54382124
1-[2-(5-hydroxypentyl)phenyl]trideca-1,3-dien-5-yl acetate (PubChem CID 54382124) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 1-[2-(5-hydroxypentyl)phenyl]trideca-1,3-dien-5-yl acetate.
| Compound Name | 1-[2-(5-hydroxypentyl)phenyl]trideca-1,3-dien-5-yl acetate |
|---|---|
| PubChem CID | 54382124 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-[2-(5-hydroxypentyl)phenyl]trideca-1,3-dien-5-yl acetate |
| SMILES | CCCCCCCCC(C=CC=Cc1ccccc1CCCCCO)OC(C)=O |
| InChI | InChI=1S/C26H40O3/c1-3-4-5-6-7-10-20-26(29-23(2)28)21-14-13-19-25-18-12-11-17-24(25)16-9-8-15-22-27/h11-14,17-19,21,26-27H,3-10,15-16,20,22H2,1-2H3 |
| InChIKey | VAQUINDNXJDWBQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|