About CID 173328565
CID 173328565 (PubChem CID 173328565) has the molecular formula C28H45O3Si
and a molecular weight of 457.75 g/mol.
Molecular Properties
| Compound Name | CID 173328565 |
| PubChem CID | 173328565 |
| Molecular Formula | C28H45O3Si |
| Molecular Weight | 457.75 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC(C=CC=Cc1cccc(C(O[Si](C)C)C(C)(C)C)c1)OC(C)=O |
| InChI | InChI=1S/C28H45O3Si/c1-8-9-10-11-12-13-20-26(30-23(2)29)21-15-14-17-24-18-16-19-25(22-24)27(28(3,4)5)31-32(6)7/h14-19,21-22,26-27H,8-13,20H2,1-7H3 |
| InChIKey | WICJCLGXJWDFPN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.75 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 173328565 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173328565?
The IUPAC name of CID 173328565 (CID 173328565) is not available.
What is the SMILES notation for CID 173328565?
The canonical SMILES for CID 173328565 is CCCCCCCCC(C=CC=Cc1cccc(C(O[Si](C)C)C(C)(C)C)c1)OC(C)=O.
What is the InChIKey of CID 173328565?
The InChIKey is WICJCLGXJWDFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45O3Si/c1-8-9-10-11-12-13-20-26(30-23(2)29)21-15-14-17-24-18-16-19-25(22-24)27(28(3,4)5)31-32(6)7/h14-19,21-22,26-27H,8-13,20H2,1-7H3.
What are the key properties of CID 173328565?
CID 173328565 has a molecular weight of 457.75 g/mol, XLogP of 8.29, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173328565 is sourced from PubChem (CID 173328565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).