C24H41O2Si — CID 67718097
CID 67718097 (PubChem CID 67718097) has the molecular formula C24H41O2Si and a molecular weight of 389.68 g/mol.
| Compound Name | CID 67718097 |
|---|---|
| PubChem CID | 67718097 |
| Molecular Formula | C24H41O2Si |
| Molecular Weight | 389.68 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC(O)C=Cc1cccc(C(O[Si](C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C24H41O2Si/c1-7-8-9-10-11-12-16-22(25)18-17-20-14-13-15-21(19-20)23(24(2,3)4)26-27(5)6/h13-15,17-19,22-23,25H,7-12,16H2,1-6H3 |
| InChIKey | ZWOOEFBQKYNLDW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|