About dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 173398579) has the molecular formula C20H42O2
and a molecular weight of 314.55 g/mol. Its IUPAC name is dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 173398579 |
| Molecular Formula | C20H42O2 |
| Molecular Weight | 314.55 g/mol |
| Exact Mass | 314.32 |
| IUPAC Name | dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(C)(C)OC(C)(C)C.CC=CC(O)CCCCCCCC |
| InChI | InChI=1S/C12H24O.C8H18O/c1-3-5-6-7-8-9-11-12(13)10-4-2;1-7(2,3)9-8(4,5)6/h4,10,12-13H,3,5-9,11H2,1-2H3;1-6H3 |
| InChIKey | MVPANTMZZBQCLE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 173398579) is dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is CC(C)(C)OC(C)(C)C.CC=CC(O)CCCCCCCC.
What is the InChIKey of dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is MVPANTMZZBQCLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O.C8H18O/c1-3-5-6-7-8-9-11-12(13)10-4-2;1-7(2,3)9-8(4,5)6/h4,10,12-13H,3,5-9,11H2,1-2H3;1-6H3.
What are the key properties of dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 314.55 g/mol, XLogP of 6.27, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-2-en-4-ol;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 173398579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).