C34H46O2Si — CID 54559685
[3-[3-[tert-butyl(diphenyl)silyl]oxyundec-1-enyl]phenyl]methanol (PubChem CID 54559685) has the molecular formula C34H46O2Si and a molecular weight of 514.83 g/mol. Its IUPAC name is [3-[3-[tert-butyl(diphenyl)silyl]oxyundec-1-enyl]phenyl]methanol.
| Compound Name | [3-[3-[tert-butyl(diphenyl)silyl]oxyundec-1-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 54559685 |
| Molecular Formula | C34H46O2Si |
| Molecular Weight | 514.83 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | [3-[3-[tert-butyl(diphenyl)silyl]oxyundec-1-enyl]phenyl]methanol |
| SMILES | CCCCCCCCC(C=Cc1cccc(CO)c1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46O2Si/c1-5-6-7-8-9-12-20-31(26-25-29-18-17-19-30(27-29)28-35)36-37(34(2,3)4,32-21-13-10-14-22-32)33-23-15-11-16-24-33/h10-11,13-19,21-27,31,35H,5-9,12,20,28H2,1-4H3 |
| InChIKey | ZPQXLMUPLCNKFS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.83 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|