C24H33IOSi — CID 10719924
tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-diphenylsilane (PubChem CID 10719924) has the molecular formula C24H33IOSi and a molecular weight of 492.52 g/mol. Its IUPAC name is tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10719924 |
| Molecular Formula | C24H33IOSi |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | tert-butyl-[(E,3R)-1-iodooct-1-en-3-yl]oxy-diphenylsilane |
| SMILES | CCCCC[C@H](/C=C/I)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H33IOSi/c1-5-6-9-14-21(19-20-25)26-27(24(2,3)4,22-15-10-7-11-16-22)23-17-12-8-13-18-23/h7-8,10-13,15-21H,5-6,9,14H2,1-4H3/b20-19+/t21-/m1/s1 |
| InChIKey | FBPZRAMNLOHAEK-RABMLOOZSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|