C27H31BrOSi — CID 15364161
[(Z)-1-bromo-5-phenylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 15364161) has the molecular formula C27H31BrOSi and a molecular weight of 479.53 g/mol. Its IUPAC name is [(Z)-1-bromo-5-phenylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(Z)-1-bromo-5-phenylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15364161 |
| Molecular Formula | C27H31BrOSi |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(Z)-1-bromo-5-phenylpent-1-en-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC(/C=C\Br)CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31BrOSi/c1-27(2,3)30(25-15-9-5-10-16-25,26-17-11-6-12-18-26)29-24(21-22-28)20-19-23-13-7-4-8-14-23/h4-18,21-22,24H,19-20H2,1-3H3/b22-21- |
| InChIKey | BVEYUTZVABTIJJ-DQRAZIAOSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|