C30H38O2Si — CID 57341570
tert-butyl-diphenyl-[(3R)-7-phenylmethoxyhept-1-en-3-yl]oxysilane (PubChem CID 57341570) has the molecular formula C30H38O2Si and a molecular weight of 458.72 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(3R)-7-phenylmethoxyhept-1-en-3-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(3R)-7-phenylmethoxyhept-1-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 57341570 |
| Molecular Formula | C30H38O2Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | tert-butyl-diphenyl-[(3R)-7-phenylmethoxyhept-1-en-3-yl]oxysilane |
| SMILES | C=C[C@@H](CCCCOCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H38O2Si/c1-5-27(19-15-16-24-31-25-26-17-9-6-10-18-26)32-33(30(2,3)4,28-20-11-7-12-21-28)29-22-13-8-14-23-29/h5-14,17-18,20-23,27H,1,15-16,19,24-25H2,2-4H3/t27-/m0/s1 |
| InChIKey | OWRMGJSHMPBWSG-MHZLTWQESA-N |
| XLogP | 6.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|