C37H53BrMgO2Si — CID 11125202
magnesium;tert-butyl-diphenyl-[(4R)-1-phenylmethoxytetradecan-4-yl]oxysilane;bromide (PubChem CID 11125202) has the molecular formula C37H53BrMgO2Si and a molecular weight of 662.12 g/mol. Its IUPAC name is magnesium;tert-butyl-diphenyl-[(4R)-1-phenylmethoxytetradecan-4-yl]oxysilane;bromide.
| Compound Name | magnesium;tert-butyl-diphenyl-[(4R)-1-phenylmethoxytetradecan-4-yl]oxysilane;bromide |
|---|---|
| PubChem CID | 11125202 |
| Molecular Formula | C37H53BrMgO2Si |
| Molecular Weight | 662.12 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | magnesium;tert-butyl-diphenyl-[(4R)-1-phenylmethoxytetradecan-4-yl]oxysilane;bromide |
| SMILES | [Br-].[CH2-]CCCCCCCCC[C@H](CCCOCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.[Mg+2] |
| InChI | InChI=1S/C37H53O2Si.BrH.Mg/c1-5-6-7-8-9-10-11-17-25-34(26-22-31-38-32-33-23-15-12-16-24-33)39-40(37(2,3)4,35-27-18-13-19-28-35)36-29-20-14-21-30-36;;/h12-16,18-21,23-24,27-30,34H,1,5-11,17,22,25-26,31-32H2,2-4H3;1H;/q-1;;+2/p-1/t34-;;/m1../s1 |
| InChIKey | RJJNYEUOERDVSW-GTUFUJRRSA-M |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.12 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|