C35H56O3Si — CID 123768020
10-[tert-butyl(diphenyl)silyl]oxynonadecanoic acid (PubChem CID 123768020) has the molecular formula C35H56O3Si and a molecular weight of 552.92 g/mol. Its IUPAC name is 10-[tert-butyl(diphenyl)silyl]oxynonadecanoic acid.
| Compound Name | 10-[tert-butyl(diphenyl)silyl]oxynonadecanoic acid |
|---|---|
| PubChem CID | 123768020 |
| Molecular Formula | C35H56O3Si |
| Molecular Weight | 552.92 g/mol |
| Exact Mass | 552.40 |
| IUPAC Name | 10-[tert-butyl(diphenyl)silyl]oxynonadecanoic acid |
| SMILES | CCCCCCCCCC(CCCCCCCCC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H56O3Si/c1-5-6-7-8-9-12-17-24-31(25-18-13-10-11-14-23-30-34(36)37)38-39(35(2,3)4,32-26-19-15-20-27-32)33-28-21-16-22-29-33/h15-16,19-22,26-29,31H,5-14,17-18,23-25,30H2,1-4H3,(H,36,37) |
| InChIKey | QBOXYCNJDFZZFI-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.92 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|