C34H46O4Si — CID 71613731
5-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(diphenyl)silyl]oxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]pentanoic acid (PubChem CID 71613731) has the molecular formula C34H46O4Si and a molecular weight of 546.82 g/mol. Its IUPAC name is 5-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(diphenyl)silyl]oxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]pentanoic acid.
| Compound Name | 5-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(diphenyl)silyl]oxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 71613731 |
| Molecular Formula | C34H46O4Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 5-[(1S,5R)-5-[(E,3S)-3-[tert-butyl(diphenyl)silyl]oxyoct-1-enyl]-4-oxocyclopent-2-en-1-yl]pentanoic acid |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C(=O)C=C[C@@H]1CCCCC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46O4Si/c1-5-6-9-17-28(24-25-31-27(23-26-32(31)35)16-14-15-22-33(36)37)38-39(34(2,3)4,29-18-10-7-11-19-29)30-20-12-8-13-21-30/h7-8,10-13,18-21,23-28,31H,5-6,9,14-17,22H2,1-4H3,(H,36,37)/b25-24+/t27-,28-,31+/m0/s1 |
| InChIKey | PNQCUMKAYBDMQD-HDDKQZKYSA-N |
| XLogP | 7.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|