C24H32O3Si — CID 23117699
(E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enoic acid (PubChem CID 23117699) has the molecular formula C24H32O3Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enoic acid.
| Compound Name | (E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enoic acid |
|---|---|
| PubChem CID | 23117699 |
| Molecular Formula | C24H32O3Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enoic acid |
| SMILES | CC(/C=C/CCCC(=O)O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O3Si/c1-20(14-8-5-13-19-23(25)26)27-28(24(2,3)4,21-15-9-6-10-16-21)22-17-11-7-12-18-22/h6-12,14-18,20H,5,13,19H2,1-4H3,(H,25,26)/b14-8+ |
| InChIKey | AQUZXKNQWNCLQU-RIYZIHGNSA-N |
| XLogP | 4.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|