C26H36O3Si — CID 58918269
[(E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl] acetate (PubChem CID 58918269) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is [(E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl] acetate.
| Compound Name | [(E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl] acetate |
|---|---|
| PubChem CID | 58918269 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [(E)-7-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C/C(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36O3Si/c1-22(16-10-6-7-15-21-28-23(2)27)29-30(26(3,4)5,24-17-11-8-12-18-24)25-19-13-9-14-20-25/h8-14,16-20,22H,6-7,15,21H2,1-5H3/b16-10+ |
| InChIKey | JTQVONXNLLMAJX-MHWRWJLKSA-N |
| XLogP | 5.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|